
CAS 91012-18-9
:α-(Aminomethyl)-α-methylbenzeneacetic acid
Description:
α-(Aminomethyl)-α-methylbenzeneacetic acid, also known as a derivative of phenylalanine, is an organic compound characterized by its amino and carboxylic acid functional groups. This compound features a benzene ring substituted with an amino group and an acetic acid moiety, which contributes to its polar nature. It is typically a white to off-white solid at room temperature and is soluble in polar solvents like water and alcohols due to the presence of the carboxylic acid group. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs that target specific receptors or enzymes. Its structural characteristics allow for potential interactions with biological systems, which can be explored for therapeutic applications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-10(7-11,9(12)13)8-5-3-2-4-6-8/h2-6H,7,11H2,1H3,(H,12,13)
InChI key:InChIKey=OKXZCUBYPSXSOW-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CN)(C)C1=CC=CC=C1
Synonyms:- α-(Aminomethyl)-α-methylbenzeneacetic acid
- Benzeneacetic acid, α-(aminomethyl)-α-methyl-
- 3-Amino-2-methyl-2-phenylpropanoic acid
- Hydratropic acid, α-(aminomethyl)-
- 3-Amino-2-methyl-2-phenyl-propionic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.