CAS 910209-21-1

sodium cyclopropanesulfinate

Description:

Sodium cyclopropanesulfinate is an organosulfur compound characterized by the presence of a cyclopropane ring and a sulfinic acid group. It is typically represented as a sodium salt, which enhances its solubility in water. This compound is known for its potential applications in organic synthesis, particularly as a reagent in various chemical reactions due to its ability to act as a nucleophile. Sodium cyclopropanesulfinate may exhibit properties such as stability under standard conditions, but it can be sensitive to heat and moisture. Its reactivity can be attributed to the presence of the sulfinic group, which can participate in oxidation and reduction reactions. Additionally, the cyclopropane moiety can influence the compound's steric and electronic properties, making it useful in the synthesis of more complex molecules. Safety data should be consulted before handling, as with any chemical substance, to ensure proper precautions are taken. Overall, sodium cyclopropanesulfinate represents a valuable tool in the field of synthetic organic chemistry.

Formula: C₃H₅NaO₂S

InChI: InChI=1/C3H6O2S.Na/c4-6(5)3-1-2-3;/h3H,1-2H2,(H,4,5);/q;+1/p-1

SMILES: C1CC1S(=O)O.[Na]

Synonyms:

• Cyclopropanesulfinic acid, sodium salt (1:1)

Sodium Cyclopropanesulfinate

CAS: 910209-21-1

Formula: C₃H₅NaO₂S

Purity: 90%

Color and Shape: Solid

Molecular weight: 128.1254

Ref: IN-DA003UC6

Sodium Cyclopropanesulfinate

CAS: 910209-21-1

Sodium Cyclopropanesulfinate

Purity: 95%

Molecular weight: 128.13g/mol

Ref: 54-OR1015016

Cyclopropanesulfinic acid, sodium salt

CAS: 910209-21-1

Formula: C₃H₅NaO₂S

Purity: 85%

Color and Shape: Solid

Molecular weight: 128.12

Ref: 10-F024941