CAS 910297-51-7
:N-(2-chloro-6-methylphenyl)-2-{[2-methyl-6-(piperazin-1-yl)pyrimidin-4-yl]amino}-1,3-thiazole-5-carboxamide
Description:
N-(2-chloro-6-methylphenyl)-2-{[2-methyl-6-(piperazin-1-yl)pyrimidin-4-yl]amino}-1,3-thiazole-5-carboxamide, with CAS number 910297-51-7, is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, a carboxamide group, and multiple aromatic and heterocyclic components. This compound features a chloro-substituted phenyl group and a piperazine moiety, contributing to its potential biological activity. The presence of the thiazole and pyrimidine rings suggests possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure indicates that it may exhibit properties such as solubility in organic solvents, stability under various conditions, and potential for specific receptor binding. The compound's design may be aimed at enhancing efficacy and selectivity in therapeutic applications, possibly in areas such as oncology or neurology. As with many synthetic compounds, its safety profile, including toxicity and pharmacokinetics, would need to be thoroughly evaluated in preclinical and clinical studies.
Formula:C20H22ClN7OS
InChI:InChI=1/C20H22ClN7OS/c1-12-4-3-5-14(21)18(12)27-19(29)15-11-23-20(30-15)26-16-10-17(25-13(2)24-16)28-8-6-22-7-9-28/h3-5,10-11,22H,6-9H2,1-2H3,(H,27,29)(H,23,24,25,26)
SMILES:Cc1cccc(c1N=C(c1cnc(Nc2cc(nc(C)n2)N2CCNCC2)s1)O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Dasatinib Related Compound B (N-(2-Chloro-6-methylphenyl)-2-{[2-methyl-6-(piperazin-1-yl)pyrimidin-4-yl]amino}thiazole-5-carboxamide)
CAS:Compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structureFormula:C20H22ClN7OSColor and Shape:White Off-White PowderMolecular weight:443.12951N-Deshydroxyethyl Dasatinib
CAS:Formula:C20H22ClN7OSPurity:97%Color and Shape:SolidMolecular weight:443.9530N-Deshydroxyethyl Dasatinib
CAS:Formula:C20H22ClN7OSColor and Shape:White To Off-White SolidMolecular weight:443.96N-Deshydroxyethyl Dasatinib
CAS:N-Deshydroxyethyl Dasatinib (N-Deshydroxyethyl BMS-354825) is a metabolite of Dasatinib, a dasatinib-based molecule that degrades ABL by binding to the IAPFormula:C20H22ClN7OSPurity:95.96%Color and Shape:SolidMolecular weight:443.95Ref: TM-T18750
1mg52.00€5mg111.00€1mL*10mM (DMSO)127.00€10mg170.00€25mg294.00€50mg425.00€100mg583.00€200mg790.00€N-Deshydroxyethyl Dasatinib
CAS:Controlled ProductFormula:C20H22ClN7OSColor and Shape:Off-WhiteMolecular weight:443.95








