CAS 910298-61-2

4-[[[4-[(4-Bromo-2-fluorophenyl)amino]-6-methoxy-7-quinazolinyl]oxy]methyl]-1-piperidinemethanol

Description:

The chemical substance known as 4-[[[4-[(4-Bromo-2-fluorophenyl)amino]-6-methoxy-7-quinazolinyl]oxy]methyl]-1-piperidinemethanol, with the CAS number 910298-61-2, is a complex organic compound characterized by its multi-functional structure. It features a quinazoline core, which is a bicyclic compound known for its biological activity, particularly in medicinal chemistry. The presence of a piperidine ring contributes to its potential pharmacological properties, while the bromo and fluoro substituents on the phenyl group may enhance its lipophilicity and influence its interaction with biological targets. The methoxy group is also significant, as it can affect the compound's solubility and reactivity. This compound is likely to be of interest in research related to drug development, particularly in the fields of oncology or neurology, due to its structural complexity and potential for specific biological activity. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be evaluated through various analytical methods to determine its efficacy and safety in potential applications.

Formula: C₂₂H₂₄BrFN₄O₃

InChI: InChI=1S/C22H24BrFN4O3/c1-30-20-9-16-19(10-21(20)31-11-14-4-6-28(13-29)7-5-14)25-12-26-22(16)27-18-3-2-15(23)8-17(18)24/h2-3,8-10,12,14,29H,4-7,11,13H2,1H3,(H,25,26,27)

InChI key: InChIKey=DOKXHMPUAQBETB-UHFFFAOYSA-N

SMILES: N(C=1C2=C(C=C(OCC3CCN(CO)CC3)C(OC)=C2)N=CN1)C4=C(F)C=C(Br)C=C4

Synonyms:

• 1-Piperidinemethanol, 4-[[[4-[(4-bromo-2-fluorophenyl)amino]-6-methoxy-7-quinazolinyl]oxy]methyl]-
• 4-[[[4-[(4-Bromo-2-fluorophenyl)amino]-6-methoxy-7-quinazolinyl]oxy]methyl]-1-piperidinemethanol
• Hydroxy Vandetanib
• Vandetanib N-Hydroxymethyl Analog

Hydroxy Vandetanib

Controlled Product

CAS: 910298-61-2

Formula: C₂₂H₂₄BrFN₄O₃

Color and Shape: Neat

Molecular weight: 491.353

Ref: TR-H995200