CymitQuimica logo

CAS 91037-91-1

:

furan-2-yl[5-(furan-2-yl)-1H-imidazol-2-yl]methanone

Description:
Furan-2-yl[5-(furan-2-yl)-1H-imidazol-2-yl]methanone, with the CAS number 91037-91-1, is an organic compound characterized by its complex structure that includes both furan and imidazole moieties. This compound features a furan ring, which is a five-membered aromatic heterocycle containing oxygen, and an imidazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of these heterocycles suggests potential biological activity, as many compounds with similar structures are known for their pharmacological properties. The methanone functional group indicates the presence of a carbonyl group (C=O) attached to a methylene bridge, which can influence the compound's reactivity and stability. Furan derivatives are often studied for their roles in organic synthesis and medicinal chemistry due to their ability to participate in various chemical reactions. Overall, this compound may exhibit interesting chemical behavior and potential applications in drug development or materials science, although specific properties such as solubility, melting point, and reactivity would require empirical investigation.
Formula:C12H8N2O3
InChI:InChI=1/C12H8N2O3/c15-11(10-4-2-6-17-10)12-13-7-8(14-12)9-3-1-5-16-9/h1-7H,(H,13,14)
SMILES:c1cc(c2cnc(C(=O)c3ccco3)[nH]2)oc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.