CAS 910381-00-9

3-(2-Aminoethyl)-1H-indole-7-carboxylic acid

Description:

3-(2-Aminoethyl)-1H-indole-7-carboxylic acid, with the CAS number 910381-00-9, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an aminoethyl side chain and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the amino group suggests it may participate in various biochemical interactions, making it of interest in medicinal chemistry and pharmacology. The carboxylic acid group can engage in hydrogen bonding and influence solubility and reactivity. Additionally, the indole moiety is known for its role in various biological processes and its presence in many natural products and pharmaceuticals. The compound's properties, such as solubility, stability, and reactivity, can be influenced by pH and the presence of other functional groups. Overall, 3-(2-Aminoethyl)-1H-indole-7-carboxylic acid is a compound with potential applications in drug development and research.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1S/C11H12N2O2/c12-5-4-7-6-13-10-8(7)2-1-3-9(10)11(14)15/h1-3,6,13H,4-5,12H2,(H,14,15)

InChI key: InChIKey=MYBUOXUYPOBGEW-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C(=C(C(O)=O)C=CC2)NC1

Synonyms:

• 1H-Indole-7-carboxylic acid, 3-(2-aminoethyl)-
• 3-(2-Aminoethyl)-1H-indole-7-carboxylic acid