
CAS 910381-20-3
:4-Bromo-2-furanethanamine
Description:
4-Bromo-2-furanethanamine, with the CAS number 910381-20-3, is an organic compound characterized by the presence of a furan ring and an amine functional group. This compound features a bromine atom substituted at the 4-position of the furan ring and an ethylamine side chain at the 2-position. The furan ring contributes to its aromatic properties, while the amine group can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of the bromine atom can enhance the compound's lipophilicity and may affect its pharmacokinetic properties. Additionally, the compound's structure suggests potential applications in organic synthesis and as a building block for more complex molecules. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.
Formula:C6H8BrNO
InChI:InChI=1S/C6H8BrNO/c7-5-3-6(1-2-8)9-4-5/h3-4H,1-2,8H2
InChI key:InChIKey=GNZCSPTUXFHTDD-UHFFFAOYSA-N
SMILES:C(CN)C1=CC(Br)=CO1
Synonyms:- 4-Bromo-2-furanethanamine
- 2-Furanethanamine, 4-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.