
CAS 910393-51-0
:2,2-Difluoro-α-methyl-1,3-benzodioxole-5-ethanamine
Description:
2,2-Difluoro-α-methyl-1,3-benzodioxole-5-ethanamine is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety and an ethanamine functional group. The presence of two fluorine atoms at the 2,2-positions contributes to its distinct reactivity and potential biological activity. The α-methyl group enhances steric hindrance, which may influence its interaction with biological targets. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility and reactivity in various solvents. Additionally, the fluorine substituents may impart lipophilicity and alter the electronic properties of the molecule, potentially enhancing its pharmacological profile. As a compound with potential applications in medicinal chemistry, understanding its characteristics, including stability, reactivity, and biological activity, is crucial for further research and development. Safety data and handling precautions should be considered due to the presence of fluorine and the amine functional group.
Formula:C10H11F2NO2
InChI:InChI=1S/C10H11F2NO2/c1-6(13)4-7-2-3-8-9(5-7)15-10(11,12)14-8/h2-3,5-6H,4,13H2,1H3
InChI key:InChIKey=BHDXKBALNFHXDV-UHFFFAOYSA-N
SMILES:FC1(F)OC=2C(=CC(CC(C)N)=CC2)O1
Synonyms:- 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)propan-2-amine
- 2,2-Difluoro-α-methyl-1,3-benzodioxole-5-ethanamine
- 1,3-Benzodioxole-5-ethanamine, 2,2-difluoro-α-methyl-
- 1-(2,2-Difluoro-2H-1,3-benzodioxol-5-yl)propan-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)propan-2-amine
CAS:Controlled ProductFormula:C10H11F2NO2Color and Shape:NeatMolecular weight:215.1971-(2,2-Difluoro-1,3-benzodioxol-5-yl)propan-2-amine-d3
CAS:Controlled ProductFormula:C10D3H8F2NO2Color and Shape:NeatMolecular weight:218.215
