
CAS 910400-66-7
:2,3-Dihydro-2-benzofuranethanamine
Description:
2,3-Dihydro-2-benzofuranethanamine, identified by its CAS number 910400-66-7, is a chemical compound that features a bicyclic structure comprising a benzofuran moiety and an ethylamine side chain. This compound is characterized by its potential biological activity, which may include interactions with neurotransmitter systems, making it of interest in medicinal chemistry and pharmacology. The presence of the benzofuran ring contributes to its aromatic properties, while the ethylamine group may influence its solubility and reactivity. Typically, compounds of this nature can exhibit a range of physical properties, including varying degrees of polarity and stability, depending on their specific functional groups and molecular interactions. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural elucidation. As with many amines, it may also exhibit basicity, allowing it to form salts with acids. Overall, 2,3-Dihydro-2-benzofuranethanamine represents a class of compounds that could have significant implications in drug development and therapeutic applications.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c11-6-5-9-7-8-3-1-2-4-10(8)12-9/h1-4,9H,5-7,11H2
InChI key:InChIKey=ZLVOQLHSCVKTGZ-UHFFFAOYSA-N
SMILES:C(CN)C1CC=2C(O1)=CC=CC2
Synonyms:- 2-Benzofuranethanamine, 2,3-dihydro-
- 2-(2,3-Dihydro-1-benzofuran-2-yl)ethanamine
- 2,3-Dihydro-2-benzofuranethanamine
- 2-(2,3-Dihydro-1-benzofuran-2-yl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.