CAS 91041-21-3
:methyl 3-(2-aminophenoxy)thiophene-2-carboxylate
Description:
Methyl 3-(2-aminophenoxy)thiophene-2-carboxylate, with the CAS number 91041-21-3, is an organic compound characterized by its complex structure that includes a thiophene ring, an amino group, and an ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. The thiophene moiety contributes to its electronic properties, potentially making it useful in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, the presence of the carboxylate group suggests that it may engage in hydrogen bonding and other intermolecular interactions, influencing its solubility and reactivity. Overall, methyl 3-(2-aminophenoxy)thiophene-2-carboxylate is of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C12H11NO3S
InChI:InChI=1/C12H11NO3S/c1-15-12(14)11-10(6-7-17-11)16-9-5-3-2-4-8(9)13/h2-7H,13H2,1H3
SMILES:COC(=O)c1c(ccs1)Oc1ccccc1N
Synonyms:- METHYL 3-(2-AMINOPHENOXY)-2-THIOPHENECARBOXYLATE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.