CAS 910442-12-5

2,9-diazaspiro[5.5]undecan-1-one

Description:

2,9-Diazaspiro[5.5]undecan-1-one is a bicyclic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a spirocyclic framework. This compound features a carbonyl group (ketone) at the 1-position, contributing to its reactivity and potential applications in organic synthesis. The presence of nitrogen atoms in the structure often imparts basic properties, making it a potential ligand in coordination chemistry. The spiro configuration can influence the compound's stereochemistry and conformational flexibility, which may affect its biological activity and interactions with other molecules. Additionally, compounds with similar structures have been studied for their potential pharmacological properties, including antimicrobial and anticancer activities. The specific properties, such as solubility, melting point, and stability, can vary based on the substituents and the overall molecular environment. Overall, 2,9-diazaspiro[5.5]undecan-1-one represents an interesting class of compounds with diverse applications in medicinal chemistry and materials science.

Formula: C₉H₁₆N₂O

InChI: InChI=1/C9H16N2O/c12-8-9(2-1-5-11-8)3-6-10-7-4-9/h10H,1-7H2,(H,11,12)

SMILES: C1CC2(CCNCC2)C(=NC1)O