CymitQuimica logo

CAS 910442-13-6

:

1-(2-Methylpropyl)-3-pyrrolidinemethanol

Description:
1-(2-Methylpropyl)-3-pyrrolidinemethanol, identified by its CAS number 910442-13-6, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a hydroxymethyl group. This compound typically exhibits properties associated with amines and alcohols, such as being a polar substance due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding. The presence of the 2-methylpropyl group contributes to its hydrophobic characteristics, potentially influencing its solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or as a building block in organic synthesis. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c1-8(2)5-10-4-3-9(6-10)7-11/h8-9,11H,3-7H2,1-2H3
InChI key:InChIKey=ONWDHDUWKQHHCA-UHFFFAOYSA-N
SMILES:C(C(C)C)N1CC(CO)CC1
Synonyms:
  • 3-Pyrrolidinemethanol, 1-(2-methylpropyl)-
  • 1-(2-Methylpropyl)-3-pyrrolidinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.