CAS 910442-14-7

1-[1-(2-methylpropyl)pyrrolidin-3-yl]methanamine

Description:

1-[1-(2-methylpropyl)pyrrolidin-3-yl]methanamine, with the CAS number 910442-14-7, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a 2-methylpropyl group and a methanamine moiety. This compound is classified as an amine, specifically a secondary amine due to the presence of two carbon-containing groups attached to the nitrogen atom. It exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the pyrrolidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the branched alkyl group may enhance lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting the central nervous system or other biological pathways. However, specific biological activity and safety profiles would require further investigation through experimental studies.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-8(2)6-11-4-3-9(5-10)7-11/h8-9H,3-7,10H2,1-2H3

SMILES: CC(C)CN1CCC(CN)C1

(1-Isobutylpyrrolidin-3-yl)methanamine

CAS: 910442-14-7

Formula: C₉H₂₀N₂

Color and Shape: Liquid

Molecular weight: 156.2685

Ref: IN-DA00GTP3