CAS 910442-18-1
:1-(2-Methoxyethyl)-N-methyl-3-pyrrolidinemethanamine
Description:
1-(2-Methoxyethyl)-N-methyl-3-pyrrolidinemethanamine, identified by its CAS number 910442-18-1, is a chemical compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a methoxyethyl side chain. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. It may also display moderate lipophilicity due to the presence of the methoxyethyl group, potentially affecting its bioavailability and interaction with biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. Additionally, its synthesis and stability under various conditions are important factors to consider for practical applications. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-10-7-9-3-4-11(8-9)5-6-12-2/h9-10H,3-8H2,1-2H3
InChI key:InChIKey=NSEJMPYQHVGIAC-UHFFFAOYSA-N
SMILES:C(COC)N1CC(CNC)CC1
Synonyms:- [[1-(2-Methoxyethyl)pyrrolidin-3-yl]methyl](methyl)amine
- 1-(2-Methoxyethyl)-N-methyl-3-pyrrolidinemethanamine
- 1-[1-(2-Methoxyethyl)pyrrolidin-3-yl]-N-methylmethanamine
- [[1-(2-Methoxyethyl)pyrrolidin-3-yl]-methyl]methylamine
- 3-Pyrrolidinemethanamine, 1-(2-methoxyethyl)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.