CAS 910442-88-5

2-(1,1-Dimethylethyl)-N-(2-fluorophenyl)-1H-indol-7-amine

Description:

2-(1,1-Dimethylethyl)-N-(2-fluorophenyl)-1H-indol-7-amine, with CAS number 910442-88-5, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a tert-butyl group (1,1-dimethylethyl) and a fluorophenyl moiety, indicating the presence of a fluorine atom on the phenyl ring, which can influence its electronic properties and reactivity. The amine functional group attached to the indole core suggests potential for hydrogen bonding and reactivity in various chemical environments. The presence of the fluorine atom may enhance lipophilicity and affect the compound's biological activity, making it of interest in pharmaceutical research. Additionally, the indole framework is often associated with various biological activities, including roles in neurotransmission and as precursors to important biomolecules. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry and drug development.

Formula: C₁₈H₁₉FN₂

InChI: InChI=1S/C18H19FN2/c1-18(2,3)16-11-12-7-6-10-15(17(12)21-16)20-14-9-5-4-8-13(14)19/h4-11,20-21H,1-3H3

InChI key: InChIKey=XZZOENWPEGKBNN-UHFFFAOYSA-N

SMILES: N(C1=C2C(C=C(C(C)(C)C)N2)=CC=C1)C3=C(F)C=CC=C3

Synonyms:

• 1H-Indol-7-amine, 2-(1,1-dimethylethyl)-N-(2-fluorophenyl)-
• 2-(1,1-Dimethylethyl)-N-(2-fluorophenyl)-1H-indol-7-amine
• (2-TERT-BUTYL-1H-INDOL-7-YL)-(2-FLUORO-PHENYL)-AMINE
• 2-TERT-BUTYL-N-(2-FLUOROPHENYL)-1H-INDOL-7-AMINE