CAS 910443-03-7

8-Chloro-5H-1,2,4-triazino[5,6-b]indol-3-amine

Description:

8-Chloro-5H-1,2,4-triazino[5,6-b]indol-3-amine is a heterocyclic compound characterized by its complex structure, which includes a triazine ring fused to an indole moiety. This compound features a chlorine atom at the 8-position and an amino group at the 3-position of the indole, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the triazine and indole rings suggests potential applications in pharmaceuticals, particularly in the development of anti-cancer or anti-inflammatory agents, due to their ability to interact with biological targets. Additionally, the chlorine substituent can influence the compound's lipophilicity and metabolic stability. As with many heterocyclic compounds, its properties can be further influenced by the presence of functional groups and the overall molecular conformation. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₆ClN₅

InChI: InChI=1S/C9H6ClN5/c10-4-1-2-6-5(3-4)7-8(12-6)13-9(11)15-14-7/h1-3H,(H3,11,12,13,15)

InChI key: InChIKey=CMVHXTZYWWTDEG-UHFFFAOYSA-N

SMILES: ClC=1C=C2C=3C(NC2=CC1)=NC(N)=NN3

Synonyms:

• 2H-1,2,4-Triazino[5,6-b]indol-3-amine, 8-chloro-
• 5H-1,2,4-Triazino[5,6-b]indol-3-amine, 8-chloro-
• 8-Chloro-5H-1,2,4-triazino[5,6-b]indol-3-amine