CAS 910443-12-8

6-(Ethylsulfonyl)-1H-indole-2-carboxylic acid

Description:

6-(Ethylsulfonyl)-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of the ethylsulfonyl group enhances its solubility and reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. This compound may exhibit biological activity, potentially serving as a pharmacophore in drug development, particularly in targeting specific enzymes or receptors. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 6-(Ethylsulfonyl)-1H-indole-2-carboxylic acid represents a versatile scaffold in chemical research, with implications in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₁NO₄S

InChI: InChI=1S/C11H11NO4S/c1-2-17(15,16)8-4-3-7-5-10(11(13)14)12-9(7)6-8/h3-6,12H,2H2,1H3,(H,13,14)

InChI key: InChIKey=KWXQBBKTDMEMGQ-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1C=C2C(C=C(C(O)=O)N2)=CC1