CAS 910443-13-9

Methyl 6-(ethylsulfonyl)-1H-indole-2-carboxylate

Description:

Methyl 6-(ethylsulfonyl)-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methyl ester functional group at the carboxylic acid position, contributing to its solubility and reactivity. The presence of the ethylsulfonyl group enhances its chemical properties, potentially influencing its biological activity and interactions. Methyl 6-(ethylsulfonyl)-1H-indole-2-carboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in fields such as organic synthesis and pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many indole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₃NO₄S

InChI: InChI=1S/C12H13NO4S/c1-3-18(15,16)9-5-4-8-6-11(12(14)17-2)13-10(8)7-9/h4-7,13H,3H2,1-2H3

InChI key: InChIKey=RDXFCGSZNCDKBE-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1C=C2C(C=C(C(OC)=O)N2)=CC1

Synonyms:

• Methyl 6-(ethylsulfonyl)-1H-indole-2-carboxylate
• 1H-Indole-2-carboxylic acid, 6-(ethylsulfonyl)-, methyl ester