CymitQuimica logo

CAS 910443-20-8

:

2-Formyl-α-phenyl-1H-pyrrole-1-acetic acid

Description:
2-Formyl-α-phenyl-1H-pyrrole-1-acetic acid is an organic compound characterized by its unique structure, which includes a pyrrole ring, an aldehyde functional group, and a carboxylic acid moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure allows for potential reactivity due to the presence of both the aldehyde and carboxylic acid groups, making it a candidate for various chemical reactions, including condensation and esterification. The compound may also exhibit biological activity, which could be of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and spectral characteristics (like NMR and IR), would be essential for identifying and characterizing the substance in laboratory settings. Additionally, safety data should be consulted to understand any hazards associated with handling this compound, including toxicity and environmental impact. Overall, 2-Formyl-α-phenyl-1H-pyrrole-1-acetic acid represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c15-9-11-7-4-8-14(11)12(13(16)17)10-5-2-1-3-6-10/h1-9,12H,(H,16,17)
InChI key:InChIKey=ZQFOLJRJRIULOB-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1C(C=O)=CC=C1)C2=CC=CC=C2
Synonyms:
  • 1H-Pyrrole-1-acetic acid, 2-formyl-α-phenyl-
  • 2-Formyl-α-phenyl-1H-pyrrole-1-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.