CAS 910443-29-7

1-(2-Chlorophenyl)-5-oxo-3-pyrrolidinecarboxamide

Description:

1-(2-Chlorophenyl)-5-oxo-3-pyrrolidinecarboxamide, identified by its CAS number 910443-29-7, is a chemical compound that features a pyrrolidine ring, which is a five-membered cyclic amine. This compound is characterized by the presence of a carboxamide functional group and a ketone, contributing to its reactivity and potential biological activity. The 2-chlorophenyl substituent indicates that there is a chlorine atom attached to a phenyl ring, which can influence the compound's lipophilicity and interaction with biological targets. The structural features suggest that it may exhibit properties relevant to medicinal chemistry, potentially acting as a pharmacophore in drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which are critical in biological systems. As with many compounds in this class, its solubility, stability, and bioavailability would be important factors to consider in any practical applications or studies. Further research would be necessary to fully elucidate its properties and potential uses in pharmaceuticals or other fields.

Formula: C₁₁H₁₁ClN₂O₂

InChI: InChI=1S/C11H11ClN2O2/c12-8-3-1-2-4-9(8)14-6-7(11(13)16)5-10(14)15/h1-4,7H,5-6H2,(H2,13,16)

InChI key: InChIKey=QBYMWCJELRJYJA-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(N)=O)C1)C2=C(Cl)C=CC=C2

Synonyms:

• 1-(2-Chlorophenyl)-5-oxo-3-pyrrolidinecarboxamide
• 3-Pyrrolidinecarboxamide, 1-(2-chlorophenyl)-5-oxo-