CAS 910443-32-2

1-(2-Furanylmethyl)-5-oxo-3-pyrrolidinecarboxamide

Description:

1-(2-Furanylmethyl)-5-oxo-3-pyrrolidinecarboxamide, identified by its CAS number 910443-32-2, is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a furan moiety. The presence of the furan ring contributes to its potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions, including electrophilic substitutions. The compound contains a carboxamide functional group, which can influence its solubility and interaction with biological systems. Typically, compounds like this may exhibit properties such as moderate polarity, which can affect their pharmacokinetics and bioavailability. Additionally, the presence of the carbonyl group (5-oxo) suggests potential for hydrogen bonding, impacting its stability and reactivity. While specific biological activities or applications may vary, compounds with similar structures are often explored for their potential in medicinal chemistry, particularly in the development of pharmaceuticals. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.

Formula: C₁₀H₁₂N₂O₃

InChI: InChI=1S/C10H12N2O3/c11-10(14)7-4-9(13)12(5-7)6-8-2-1-3-15-8/h1-3,7H,4-6H2,(H2,11,14)

InChI key: InChIKey=BKYKVICDINFOJM-UHFFFAOYSA-N

SMILES: C(N1CC(C(N)=O)CC1=O)C2=CC=CO2

Synonyms:

• 3-Pyrrolidinecarboxamide, 1-(2-furanylmethyl)-5-oxo-
• 1-(2-Furanylmethyl)-5-oxo-3-pyrrolidinecarboxamide