
CAS 910443-90-2
:α-(Aminomethyl)-2-methoxybenzenepropanoic acid
Description:
α-(Aminomethyl)-2-methoxybenzenepropanoic acid, also known by its CAS number 910443-90-2, is an organic compound characterized by its structure, which includes an aminomethyl group, a methoxy-substituted benzene ring, and a propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding and participate in various chemical reactions, such as nucleophilic substitutions. The methoxy group can influence the compound's solubility and reactivity, while the propanoic acid component may impart acidic characteristics. This compound may be of interest in pharmaceutical research due to its potential role as a building block in drug synthesis or as a bioactive molecule. Its specific applications and interactions would depend on further studies, including its pharmacokinetics, mechanism of action, and therapeutic potential. As with any chemical substance, safety and handling precautions should be observed when working with it in a laboratory setting.
Formula:C11H15NO3
InChI:InChI=1S/C11H15NO3/c1-15-10-5-3-2-4-8(10)6-9(7-12)11(13)14/h2-5,9H,6-7,12H2,1H3,(H,13,14)
InChI key:InChIKey=VAUZLAIDYQRQJT-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)CN)C1=C(OC)C=CC=C1
Synonyms:- Benzenepropanoic acid, α-(aminomethyl)-2-methoxy-
- α-(Aminomethyl)-2-methoxybenzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.