CAS 910443-94-6

2-(aminomethyl)-3-[4-(trifluoromethoxy)phenyl]propanoic acid

Description:

2-(Aminomethyl)-3-[4-(trifluoromethoxy)phenyl]propanoic acid, identified by its CAS number 910443-94-6, is a chemical compound characterized by its unique structural features. It contains an amino group (-NH2) attached to a propanoic acid backbone, which contributes to its potential as an amino acid derivative. The presence of a trifluoromethoxy group (-O-CF3) on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the carboxylic acid functional group, while the trifluoromethoxy substituent can impart distinctive electronic properties. Such structural attributes suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug design and synthesis. Overall, its unique combination of functional groups positions it as a potentially valuable compound in various chemical and biological applications.

Formula: C₁₁H₁₂F₃NO₃

InChI: InChI=1/C11H12F3NO3/c12-11(13,14)18-9-3-1-7(2-4-9)5-8(6-15)10(16)17/h1-4,8H,5-6,15H2,(H,16,17)

SMILES: c1cc(ccc1CC(CN)C(=O)O)OC(F)(F)F

Synonyms:

• 3-Amino-2-[4-(trifluoromethoxy)benzyl]propanoic acid
• Benzenepropanoic acid, α-(aminomethyl)-4-(trifluoromethoxy)-