CAS 910444-16-5

α-(Aminomethyl)-2-naphthalenepropanoic acid

Description:

α-(Aminomethyl)-2-naphthalenepropanoic acid, also known by its CAS number 910444-16-5, is a chemical compound characterized by its structure, which includes a naphthalene ring and an amino acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with solubility influenced by the presence of the amino group and the carboxylic acid functional group, which can engage in hydrogen bonding. The naphthalene component may impart hydrophobic characteristics, while the amino and carboxylic acid groups can enhance its polarity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1S/C14H15NO2/c15-9-13(14(16)17)8-10-5-6-11-3-1-2-4-12(11)7-10/h1-7,13H,8-9,15H2,(H,16,17)

InChI key: InChIKey=VGGPAIUIZHYAIQ-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=CC2=C(C=C1)C=CC=C2

Synonyms:

• 2-Naphthalenepropanoic acid, α-(aminomethyl)-
• 3-Amino-2-(naphthalen-2-ylmethyl)propanoic acid
• α-(Aminomethyl)-2-naphthalenepropanoic acid