
CAS 910444-18-7
:α-(Aminomethyl)-3-pyridinepropanoic acid
Description:
α-(Aminomethyl)-3-pyridinepropanoic acid, also known by its CAS number 910444-18-7, is an organic compound characterized by its pyridine and amino acid structure. This substance features a pyridine ring, which contributes to its aromatic properties, and an aminomethyl group that enhances its reactivity and potential for forming hydrogen bonds. The presence of a carboxylic acid functional group gives it acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions, due to the pyridine moiety's role in modulating neurotransmitter systems. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility in polar solvents and stability under standard conditions are typical for similar compounds, although specific solubility and stability data would depend on the environmental conditions. Overall, α-(Aminomethyl)-3-pyridinepropanoic acid represents a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c10-5-8(9(12)13)4-7-2-1-3-11-6-7/h1-3,6,8H,4-5,10H2,(H,12,13)
InChI key:InChIKey=UZBPYZHLMRSEAL-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)CN)C=1C=CC=NC1
Synonyms:- α-(Aminomethyl)-3-pyridinepropanoic acid
- 3-Pyridinepropanoic acid, α-(aminomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.