CAS 910444-68-7
:2-(2,5-dimethoxyphenyl)piperazine
Description:
2-(2,5-Dimethoxyphenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 2,5-dimethoxyphenyl group attached to the piperazine, contributing to its unique properties. The presence of methoxy groups enhances its lipophilicity and can influence its biological activity. Typically, compounds like this may exhibit psychoactive properties and are of interest in pharmacological research, particularly in the study of serotonin receptors. The molecular structure suggests potential interactions with neurotransmitter systems, which could lead to various effects on mood and cognition. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the piperazine moiety. As with many piperazine derivatives, safety and toxicity profiles are essential considerations in both research and potential therapeutic applications. Overall, 2-(2,5-dimethoxyphenyl)piperazine represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C12H18N2O2
InChI:InChI=1/C12H18N2O2/c1-15-9-3-4-12(16-2)10(7-9)11-8-13-5-6-14-11/h3-4,7,11,13-14H,5-6,8H2,1-2H3
SMILES:COc1ccc(c(c1)C1CNCCN1)OC
Synonyms:- Piperazine, 2-(2,5-Dimethoxyphenyl)-
- 2-(2,5-Dimethoxyphenyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
