CAS 910444-70-1
:2-(3,5-dimethoxyphenyl)piperazine
Description:
2-(3,5-Dimethoxyphenyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a phenyl group substituted with two methoxy groups at the 3 and 5 positions, contributing to its unique properties. The presence of these methoxy groups enhances the lipophilicity and may influence the compound's biological activity, potentially affecting its interaction with various receptors in the central nervous system. The molecular structure suggests that it may exhibit psychoactive properties, making it of interest in pharmacological research. Additionally, the compound's solubility, stability, and reactivity can be influenced by the methoxy substitutions, which may also affect its synthesis and purification processes. As with many piperazine derivatives, it may be studied for its potential therapeutic applications, including anxiolytic or antidepressant effects, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed due to the potential for unknown effects in biological systems.
Formula:C12H18N2O2
InChI:InChI=1/C12H18N2O2/c1-15-10-5-9(6-11(7-10)16-2)12-8-13-3-4-14-12/h5-7,12-14H,3-4,8H2,1-2H3
SMILES:COc1cc(cc(c1)OC)C1CNCCN1
Synonyms:- Piperazine, 2-(3,5-Dimethoxyphenyl)-
- 2-(3,5-Dimethoxyphenyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
