CAS 910487-58-0: 2-[[6-Amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]-2-pyridinyl]thio]acetamide
Description:2-[[6-Amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]-2-pyridinyl]thio]acetamide, with the CAS number 910487-58-0, is a chemical compound characterized by its complex structure, which includes a pyridine ring, multiple cyano groups, and a thioacetamide functional group. This compound features a cyclopropylmethoxy substituent on the phenyl ring, contributing to its unique properties. It is likely to exhibit significant biological activity due to the presence of the amino and cyano groups, which can participate in various chemical reactions and interactions. The thioacetamide moiety may enhance its solubility and reactivity. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of multiple functional groups suggests that it may engage in hydrogen bonding and other intermolecular interactions, influencing its stability and reactivity in different environments. Overall, this compound represents a class of molecules with potential utility in medicinal chemistry and related fields.
Formula:C19H17N5O2S
InChI:InChI=1S/C19H17N5O2S/c20-7-14-17(12-3-5-13(6-4-12)26-9-11-1-2-11)15(8-21)19(24-18(14)23)27-10-16(22)25/h3-6,11H,1-2,9-10H2,(H2,22,25)(H2,23,24)
InChI key:InChIKey=ZTYHZMAZUWOXNC-UHFFFAOYSA-N
SMILES:N#CC1=C(N=C(N)C(C#N)=C1C=2C=CC(OCC3CC3)=CC2)SCC(=O)N
- Synonyms:
- 2-[6-Amino-3,5-dicyano-4-(4-cyclopropylmethoxy-phenyl)-pyridin-2-ylsulfanyl]-acetamide
- BAY 60-6583
- 2-[[6-Amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]-2-pyridinyl]thio]acetamide
- BR 4887
- Acetamide, 2-[[6-amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]-2-pyridinyl]thio]-
![2-[[6-Amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]-2-pyridinyl]thio]acetamide](https://static.cymitquimica.com/cas-image/304132-bay-60-6583.png)
