CAS 91054-33-0
:2-Acetylbenzonitrile
Description:
2-Acetylbenzonitrile, with the CAS number 91054-33-0, is an organic compound that features both an acetyl group and a nitrile group attached to a benzene ring. This compound typically appears as a white to off-white solid and is known for its aromatic characteristics due to the presence of the benzene ring. It has a molecular formula that reflects its structure, incorporating both carbonyl (C=O) and cyano (C≡N) functionalities. 2-Acetylbenzonitrile is often used in organic synthesis and can serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its properties include moderate solubility in organic solvents, and it may exhibit distinct reactivity patterns due to the electron-withdrawing nature of the nitrile group, which can influence its behavior in chemical reactions. Additionally, it may have applications in materials science and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H7NO
InChI:InChI=1/C9H7NO/c1-7(11)9-5-3-2-4-8(9)6-10/h2-5H,1H3
SMILES:CC(=O)c1ccccc1C#N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetylbenzonitrile
CAS:2-AcetylbenzonitrileFormula:C9H7NOPurity:97%Color and Shape: off-white to light yellow solidMolecular weight:145.16g/mol2'-Cyanoacetophenone
CAS:2-Cyanoacetophenone is a prothioconazole that is used in the synthesis of other organic compounds. It is synthesized using an asymmetric synthesis, and its structure consists of an active methylene group with a chelate ring and a water molecule. 2-Cyanoacetophenone has a hydroxyl group and a bifunctional nature. The compound also has acidic properties, which are due to the hydrogen bond between the hydroxyl group and the carboxylic acid moiety. The compound's coordination geometry is octahedral, with six ligands surrounding it, including two copper ions. 2-Cyanoacetophenone can be found in thermodynamic data for copper complexes and vibrational spectroscopy.
Formula:C9H7NOPurity:Min. 95%Molecular weight:145.16 g/mol



