CAS 91054-51-2
:1-(3-methylpyridin-2-yl)propan-2-amine
Description:
1-(3-Methylpyridin-2-yl)propan-2-amine, with the CAS number 91054-51-2, is an organic compound characterized by its structure, which includes a propan-2-amine backbone substituted with a 3-methylpyridine group. This compound typically exhibits basic properties due to the presence of the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and protonation. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the pyridine ring contributes to its aromatic characteristics, which can influence its reactivity and interaction with other molecules. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in polar solvents is expected, while its lipophilicity may vary based on the substituents present. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14N2
InChI:InChI=1/C9H14N2/c1-7-4-3-5-11-9(7)6-8(2)10/h3-5,8H,6,10H2,1-2H3
SMILES:Cc1cccnc1CC(C)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.