CAS 91061-68-6

5-Ethyl-γ-oxo-2-thiophenebutanoic acid

Description:

5-Ethyl-γ-oxo-2-thiophenebutanoic acid, identified by its CAS number 91061-68-6, is an organic compound characterized by its unique structure that includes a thiophene ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both thiophenes and carboxylic acids, such as moderate solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid group. The ethyl group contributes to its hydrophobic characteristics, while the γ-oxo group introduces a carbonyl functionality that can participate in various chemical reactions, including condensation and nucleophilic addition. The thiophene moiety may also impart specific electronic properties, making it useful in organic synthesis and materials science. Overall, 5-Ethyl-γ-oxo-2-thiophenebutanoic acid is of interest in research and applications related to pharmaceuticals, agrochemicals, and organic electronics, owing to its structural features and potential reactivity.

Formula: C₁₀H₁₂O₃S

InChI: InChI=1S/C10H12O3S/c1-2-7-3-5-9(14-7)8(11)4-6-10(12)13/h3,5H,2,4,6H2,1H3,(H,12,13)

InChI key: InChIKey=CQZPZVGEZHGESA-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(=O)C=1SC(CC)=CC1

Synonyms:

• 2-Thiophenebutyric acid, 5-ethyl-γ-oxo-
• 2-Thiophenebutanoic acid, 5-ethyl-γ-oxo-
• 5-Ethyl-γ-oxo-2-thiophenebutanoic acid
• 4-(5-Ethyl-2-thienyl)-4-oxobutanoic acid