CAS 91064-26-5

1-(3,5-Dichlorophenyl)-5-oxo-3-pyrrolidinecarboxylic acid

Description:

1-(3,5-Dichlorophenyl)-5-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 91064-26-5, is a chemical compound that features a pyrrolidine ring substituted with a carboxylic acid and a ketone functional group. The presence of the 3,5-dichlorophenyl group indicates that the compound has two chlorine atoms attached to the aromatic ring, which can significantly influence its chemical reactivity and biological activity. This compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolidine framework is often found in biologically active molecules. Additionally, the dichlorophenyl moiety may enhance the compound's lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₁₁H₉Cl₂NO₃

InChI: InChI=1S/C11H9Cl2NO3/c12-7-2-8(13)4-9(3-7)14-5-6(11(16)17)1-10(14)15/h2-4,6H,1,5H2,(H,16,17)

InChI key: InChIKey=GPHFWWLZHYCCJC-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(O)=O)C1)C2=CC(Cl)=CC(Cl)=C2

Synonyms:

• 1-(3,5-Dichlorophenyl)-5-Oxopyrrolidine-3-Carboxylic Acid
• 1-(3,5-Dichlorophenyl)-5-oxo-3-pyrrolidinecarboxylic acid
• 1-(3,5-Dichlorophenyl)-5-oxo-pyrrolidine-3-carboxylic acid
• 3-Pyrrolidinecarboxylic Acid, 1-(3,5-Dichlorophenyl)-5-Oxo-

1-(3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylic acid

CAS: 91064-26-5

Formula: C₁₁H₉Cl₂NO₃

Molecular weight: 274.1

Ref: 10-F370992