CAS 91064-29-8
:2,6-Dichloro-N-methyl-N-phenyl-4-pyrimidinamine
Description:
2,6-Dichloro-N-methyl-N-phenyl-4-pyrimidinamine, with the CAS number 91064-29-8, is a chemical compound characterized by its pyrimidine ring structure, which is substituted at the 2 and 6 positions with chlorine atoms. The presence of a methyl group and a phenyl group attached to the nitrogen atoms enhances its chemical properties and reactivity. This compound is typically classified as an aromatic amine, which can exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound may also display specific solubility characteristics, stability under various conditions, and reactivity with other chemical species, which are important for its handling and application in laboratory settings. Safety data should be consulted to understand its toxicity and environmental impact, as with any chemical substance.
Formula:C11H9Cl2N3
InChI:InChI=1S/C11H9Cl2N3/c1-16(8-5-3-2-4-6-8)10-7-9(12)14-11(13)15-10/h2-7H,1H3
InChI key:InChIKey=QUVADLWDSDBZDK-UHFFFAOYSA-N
SMILES:N(C)(C=1C=C(Cl)N=C(Cl)N1)C2=CC=CC=C2
Synonyms:- 4-Pyrimidinamine, 2,6-dichloro-N-methyl-N-phenyl-
- Pyrimidine, 2,4-dichloro-6-(N-methylanilino)-
- (2,6-Dichloro-pyrimidin-4-yl)-methyl-phenyl-amine
- 2,6-Dichloro-N-methyl-N-phenyl-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
