
CAS 910649-53-5
:5-(Methylsulfonyl)-3-pyridinol
Description:
5-(Methylsulfonyl)-3-pyridinol, with the CAS number 910649-53-5, is a chemical compound characterized by its pyridine ring structure substituted with a methylsulfonyl group and a hydroxyl group. This compound typically exhibits properties associated with both pyridine derivatives and sulfonyl compounds, including potential solubility in polar solvents due to the presence of the hydroxyl group. It may also display biological activity, making it of interest in pharmaceutical research. The methylsulfonyl group can influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the nitrogen atom in the pyridine ring contributes to its basicity and potential for forming hydrogen bonds. Overall, 5-(Methylsulfonyl)-3-pyridinol is a versatile compound that may find applications in medicinal chemistry and related fields, although specific applications would depend on further research into its biological properties and mechanisms of action.
Formula:C6H7NO3S
InChI:InChI=1S/C6H7NO3S/c1-11(9,10)6-2-5(8)3-7-4-6/h2-4,8H,1H3
InChI key:InChIKey=YSZJVVMCWVOLHW-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C=C(O)C=NC1
Synonyms:- 5-(Methylsulfonyl)-3-pyridinol
- 5-(Methylsulfonyl)pyridin-3-ol
- 3-Pyridinol, 5-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.