CAS 91088-55-0
:N-acetyl-S-(4-nitrophenyl)-L-cysteine
Description:
N-acetyl-S-(4-nitrophenyl)-L-cysteine is a synthetic compound that belongs to the class of amino acid derivatives, specifically a modified form of the amino acid cysteine. It features an acetyl group and a nitrophenyl group attached to the sulfur atom of cysteine, which contributes to its unique chemical properties. This compound is typically characterized by its molecular structure, which includes a thiol (-SH) group, an amine (-NH2) group, and a carboxylic acid (-COOH) group, making it a polar molecule. The presence of the nitrophenyl group enhances its reactivity and can influence its biological activity, potentially making it useful in various biochemical applications, including studies related to redox reactions and as a potential biomarker. Additionally, the acetylation of the cysteine moiety can affect its solubility and stability in different environments. As with many chemical substances, safety and handling precautions should be observed due to its potential reactivity and biological implications.
Formula:C11H12N2O5S
InChI:InChI=1/C11H12N2O5S/c1-7(14)12-10(11(15)16)6-19-9-4-2-8(3-5-9)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16)/t10-/m0/s1
SMILES:CC(=N[C@@H](CSc1ccc(cc1)N(=O)=O)C(=O)O)O
Synonyms:- L-cysteine, N-acetyl-S-(4-nitrophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-Acetyl-S-(4-nitrophenyl)-L-cysteine
CAS:Formula:C11H12N2O5SPurity:>98.0%(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:284.29N-Acetyl-S-(4-nitrophenyl)-L-cysteine
CAS:Formula:C11H12N2O5SPurity:98.0%Color and Shape:SolidMolecular weight:284.2884S-(4-Nitrophenyl)mercapturic Acid
CAS:Controlled ProductApplications Used as a marker for low levels of exposure to benzene in industry.
References van Sittert, N.J., et al.: Br. J. Med., 50, 460 (1993), Boogaard, P.J. and van Sittert, H.J.: Occup. Environ. Med., 52, 611 (1995)Formula:C11H12N2O5SColor and Shape:NeatMolecular weight:284.29S-(4-Nitrophenyl)mercapturic acid
CAS:S-(4-Nitrophenyl)mercapturic acid (S-NPMA) is the major metabolite of 4-nitrophenol, which is a precursor to dyes and pharmaceuticals. S-NPMA has been detected in urine samples from humans, rats, and mice. The main metabolic pathway for S-NPMA is an oxidative conversion by cytochrome P450 enzymes. S-NPMA has been found to be a useful biomarker for the presence of polycyclic aromatic hydrocarbons in wastewater and human urine. The levels of this compound have also been shown to increase with age in humans.
Purity:Min. 95%Molecular weight:284.29 g/mol






