CymitQuimica logo

CAS 910904-64-2

:

5-Nitro-N-[4-[2-(1-pyrrolidinyl)ethoxy]phenyl]-2-pyrimidinamine

Description:
5-Nitro-N-[4-[2-(1-pyrrolidinyl)ethoxy]phenyl]-2-pyrimidinamine, with the CAS number 910904-64-2, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a nitro group, which is known for its electron-withdrawing properties, enhancing the compound's reactivity. The presence of a pyrrolidine moiety suggests potential interactions with biological systems, as pyrrolidine rings are often found in various pharmacologically active compounds. The ethoxy group contributes to the compound's solubility and may influence its lipophilicity, affecting its absorption and distribution in biological contexts. The overall structure indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. Additionally, the compound's unique functional groups may allow for specific interactions with enzymes or receptors, making it a candidate for further investigation in drug discovery. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with nitro compounds.
Formula:C16H19N5O3
InChI:InChI=1S/C16H19N5O3/c22-21(23)14-11-17-16(18-12-14)19-13-3-5-15(6-4-13)24-10-9-20-7-1-2-8-20/h3-6,11-12H,1-2,7-10H2,(H,17,18,19)
InChI key:InChIKey=FJWKTOUIHYOUKL-UHFFFAOYSA-N
SMILES:N(C=1N=CC(N(=O)=O)=CN1)C2=CC=C(OCCN3CCCC3)C=C2
Synonyms:
  • 2-Pyrimidinamine, 5-nitro-N-[4-[2-(1-pyrrolidinyl)ethoxy]phenyl]-
  • 5-Nitro-N-[4-[2-(1-pyrrolidinyl)ethoxy]phenyl]-2-pyrimidinamine
  • (5-Nitropyrimidin-2-yl)[4-[2-(Pyrrolidin-1-yl)ethoxy]phenyl]Amine
  • N-(5-Nitropyrimidin-2-yl)-N-[4-(2-(pyrrolidin-1-yl)ethoxy)phenyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.