CAS 91093-42-4
:2-amino-4-phenylpyrimidine-5-carboxylic acid
Description:
2-Amino-4-phenylpyrimidine-5-carboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) that contribute to its polar nature, enhancing its solubility in polar solvents such as water. The presence of the phenyl group (a benzene ring) at the 4-position of the pyrimidine ring adds to its hydrophobic characteristics, influencing its interactions in biological systems. This compound is of interest in medicinal chemistry due to its potential biological activity, including roles in enzyme inhibition and as a building block for pharmaceuticals. Its molecular structure allows for various functional modifications, making it a versatile intermediate in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment, particularly due to the carboxylic acid group, which can exist in both protonated and deprotonated forms depending on the conditions.
Formula:C11H9N3O2
InChI:InChI=1/C11H9N3O2/c12-11-13-6-8(10(15)16)9(14-11)7-4-2-1-3-5-7/h1-6H,(H,15,16)(H2,12,13,14)
SMILES:c1ccc(cc1)c1c(c[nH]c(=N)n1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.