CAS 91110-24-6
:2,3,5-Tris-O-benzyl-beta-D-ribofuranose acetate
Description:
2,3,5-Tris-O-benzyl-beta-D-ribofuranose acetate is a glycoside derivative of ribofuranose, characterized by the presence of three benzyl groups and an acetate moiety. This compound is typically a white to off-white solid, soluble in organic solvents such as dichloromethane and ethyl acetate, but less soluble in water due to its hydrophobic benzyl groups. The presence of the benzyl groups enhances its stability and lipophilicity, making it useful in various organic synthesis applications, particularly in the field of carbohydrate chemistry. The acetate group serves as a protecting group, which can be removed under specific conditions to yield the free hydroxyl groups of ribofuranose. This compound is often utilized in the synthesis of nucleosides and other carbohydrate derivatives, playing a crucial role in the development of pharmaceuticals and biochemicals. Its structure allows for selective reactions, making it a valuable intermediate in synthetic pathways. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C28H30O6
InChI:InChI=1/C28H30O6/c1-21(29)33-28-27(32-19-24-15-9-4-10-16-24)26(31-18-23-13-7-3-8-14-23)25(34-28)20-30-17-22-11-5-2-6-12-22/h2-16,25-28H,17-20H2,1H3/t25-,26-,27-,28-/m1/s1
SMILES:CC(=O)O[C@H]1[C@@H]([C@@H]([C@@H](COCc2ccccc2)O1)OCc1ccccc1)OCc1ccccc1
Synonyms:- 1-O-Acetyl-2,3,5-tri-O-benzyl-beta-D-ribofuranose
- 1-O-Acetyl-2,3,5-tri-O-benzyl-β-D-ribofuranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-O-Acetyl-2,3,5-tri-O-benzyl-b-D-ribofuranose
CAS:Formula:C28H30O6Color and Shape:LiquidMolecular weight:462.53421-O-Acetyl-2,3,5-Tri-O-Benzyl-b-D-Ribofuranose extrapure, 95%
CAS:Formula:C28H30O6Molecular weight:462.531-O-Acetyl-2,3,5-tri-O-benzyl-b-D-ribofuranose
CAS:1-O-Acetyl-2,3,5-tri-O-benzyl-b-D-ribofuranose is a synthetic sugar that has been modified with various chemical groups. It is a methylated saccharide and can be used for the synthesis of oligosaccharides or polysaccharides. 1-O-Acetyl-2,3,5-tri-O-benzyl-b-D-ribofuranose is soluble in water and ethanol. The purity of this product is greater than 98% and the CAS number is 91110–24–6.Formula:C28H30O6Purity:Min. 95%Color and Shape:Colourless syrup.Molecular weight:462.53 g/mol




