CAS 911107-22-7
:(2R)-2-phenyl-2H-chromene-3-carbaldehyde
Description:
(2R)-2-phenyl-2H-chromene-3-carbaldehyde is a chemical compound characterized by its chromene structure, which features a fused benzene and pyran ring. This compound has a phenyl group attached to the second carbon of the chromene, contributing to its aromatic properties. The presence of the aldehyde functional group at the 3-position indicates that it can participate in various chemical reactions, such as oxidation and condensation. The stereochemistry denoted by (2R) suggests a specific spatial arrangement of atoms, which can influence its reactivity and interactions with biological systems. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and organic synthesis. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its practical applications. Overall, (2R)-2-phenyl-2H-chromene-3-carbaldehyde is a versatile compound with potential uses in various fields, including pharmaceuticals and materials science.
Formula:C16H12O2
InChI:InChI=1/C16H12O2/c17-11-14-10-13-8-4-5-9-15(13)18-16(14)12-6-2-1-3-7-12/h1-11,16H/t16-/m1/s1
SMILES:c1ccc(cc1)[C@@H]1C(=Cc2ccccc2O1)C=O
Synonyms:- (2R)-2-Phenyl-2H-chromen-3-carbaldehyd
- 2H-1-benzopyran-3-carboxaldehyde, 2-phenyl-, (2R)-
- (2R)-2-Phenyl-2H-chromene-3-carbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.