
CAS 911113-64-9
:1-(Acetylamino)cyclopentaneacetic acid
Description:
1-(Acetylamino)cyclopentaneacetic acid is an organic compound characterized by its unique structure, which includes a cyclopentane ring, an acetylamino group, and an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the acetylamino group suggests that it may participate in various chemical reactions, including acylation and amidation. Additionally, the cyclopentane ring contributes to the compound's three-dimensional conformation, potentially affecting its biological activity and interaction with other molecules. The compound may be of interest in medicinal chemistry due to its structural features, which could lead to specific pharmacological properties. Its CAS number, 911113-64-9, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data in chemical databases. Overall, 1-(Acetylamino)cyclopentaneacetic acid represents a versatile structure with potential applications in various fields of chemistry and biochemistry.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c1-7(11)10-9(6-8(12)13)4-2-3-5-9/h2-6H2,1H3,(H,10,11)(H,12,13)
InChI key:InChIKey=VVFHZXYODMIYDM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1(NC(C)=O)CCCC1
Synonyms:- Cyclopentaneacetic acid, 1-(acetylamino)-
- (1-Acetylaminocyclopentyl)acetic acid
- 1-(Acetylamino)cyclopentaneacetic acid
- 2-(1-Acetamidocyclopentyl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.