CymitQuimica logo

CAS 91113-71-2

:

Boroxin, tris(4-ethylphenyl)-

Description:
Boroxin, tris(4-ethylphenyl)-, identified by the CAS number 91113-71-2, is an organoboron compound characterized by the presence of a boron atom bonded to three 4-ethylphenyl groups. This compound typically exhibits properties associated with organoboron chemistry, such as potential applications in organic synthesis, materials science, and as a precursor in the development of boron-containing polymers. The presence of ethyl groups on the phenyl rings can enhance the solubility and stability of the compound in various solvents, making it suitable for diverse chemical applications. Additionally, boron compounds like Boroxin can play a role in catalysis and may exhibit unique electronic properties due to the boron atom's ability to form coordinate bonds. The specific reactivity and stability of Boroxin, tris(4-ethylphenyl)- would depend on its molecular structure and the surrounding chemical environment, which can influence its behavior in reactions and interactions with other substances.
Formula:C24H27B3O3
InChI:InChI=1S/C24H27B3O3/c1-4-19-7-13-22(14-8-19)25-28-26(23-15-9-20(5-2)10-16-23)30-27(29-25)24-17-11-21(6-3)12-18-24/h7-18H,4-6H2,1-3H3
InChI key:InChIKey=UAGGXRGPFNTPTD-UHFFFAOYSA-N
SMILES:C(C)C1=CC=C(B2OB(OB(O2)C3=CC=C(CC)C=C3)C4=CC=C(CC)C=C4)C=C1
Synonyms:
  • Boroxin, tris(4-ethylphenyl)-
  • Boroxin, tris(p-ethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.