CAS 91121-67-4

4-oxo-4-[4-(propan-2-yloxy)phenyl]butanoic acid

Description:

4-Oxo-4-[4-(propan-2-yloxy)phenyl]butanoic acid, with the CAS number 91121-67-4, is an organic compound characterized by its functional groups and structural features. It contains a butanoic acid moiety, which contributes to its acidity, and a ketone group (4-oxo) that enhances its reactivity. The presence of a propan-2-yloxy group attached to a phenyl ring indicates that it has ether characteristics, which can influence its solubility and interaction with other molecules. This compound may exhibit properties such as moderate polarity due to the combination of hydrophobic (aromatic) and hydrophilic (carboxylic acid) regions. Its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, where the unique combination of functional groups can facilitate various chemical reactions. Additionally, the presence of the aromatic ring may impart stability and influence the compound's electronic properties. Overall, the characteristics of this compound make it a subject of interest in chemical research and development.

Formula: C₁₃H₁₆O₄

InChI: InChI=1/C13H16O4/c1-9(2)17-11-5-3-10(4-6-11)12(14)7-8-13(15)16/h3-6,9H,7-8H2,1-2H3,(H,15,16)

SMILES: CC(C)Oc1ccc(cc1)C(=O)CCC(=O)O

4-Oxo-4-(4-isopropoxyphenyl)butyric acid

CAS: 91121-67-4

Formula: C₁₃H₁₆O₄

Purity: 97.0%

Molecular weight: 236.267

Ref: 10-F207392