CymitQuimica logo

CAS 91121-69-6

:

5-[4-(2-methylpropyl)phenyl]-5-oxopentanoic acid

Description:
5-[4-(2-Methylpropyl)phenyl]-5-oxopentanoic acid, with the CAS number 91121-69-6, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone substituted with a phenyl group and a ketone functional group. This compound features a branched alkyl group (2-methylpropyl) attached to the phenyl ring, contributing to its hydrophobic characteristics. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The ketone group (C=O) enhances its reactivity, allowing for potential applications in organic synthesis and medicinal chemistry. Its molecular structure suggests that it may have interesting biological activities, although specific biological properties would require further investigation. Overall, this compound's unique functional groups and structural features make it a subject of interest in various chemical research fields, including pharmaceuticals and materials science.
Formula:C15H20O3
InChI:InChI=1/C15H20O3/c1-11(2)10-12-6-8-13(9-7-12)14(16)4-3-5-15(17)18/h6-9,11H,3-5,10H2,1-2H3,(H,17,18)
SMILES:CC(C)Cc1ccc(cc1)C(=O)CCCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.