CAS 911210-48-5

B-(3-Cyano-4-methoxyphenyl)boronic acid

Description:

B-(3-Cyano-4-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that features both a cyano and a methoxy substituent. This compound typically exhibits properties such as being a white to off-white solid at room temperature, with moderate solubility in polar organic solvents. The cyano group contributes to its potential as a versatile building block in organic synthesis, particularly in cross-coupling reactions like Suzuki-Miyaura coupling, which is widely used in the formation of carbon-carbon bonds. The methoxy group can influence the electronic properties of the molecule, enhancing its reactivity and solubility. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in various applications, including drug delivery and sensor technology. Overall, B-(3-Cyano-4-methoxyphenyl)boronic acid is a valuable compound in synthetic organic chemistry and materials science.

Formula: C₈H₈BNO₃

InChI: InChI=1S/C8H8BNO3/c1-13-8-3-2-7(9(11)12)4-6(8)5-10/h2-4,11-12H,1H3

InChI key: InChIKey=BBOOIZOUHWDLHU-UHFFFAOYSA-N

SMILES: C(#N)C1=C(OC)C=CC(B(O)O)=C1

Synonyms:

• Boronic acid, (3-cyano-4-methoxyphenyl)-
• 3-Cyano-4-methoxyphenylboronic acid
• 4-Methoxy-3-cyanophenylboronic acid
• Boronic acid, B-(3-cyano-4-methoxyphenyl)-
• B-(3-Cyano-4-methoxyphenyl)boronic acid

(3-cyano-4-methoxyphenyl)boronicacid

CAS: 911210-48-5

Formula: C₈H₈BNO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 176.9650

Ref: IN-DA00IGHS

3-Cyano-4-methoxyphenylboronic acid

CAS: 911210-48-5

3-Cyano-4-methoxyphenylboronic acid

Purity: 95%

Molecular weight: 176.97g/mol

Ref: 54-OR908389

3-Cyano-4-methoxyphenylboronic acid

CAS: 911210-48-5

Formula: C₈H₈BNO₃

Purity: 95%

Color and Shape: No data available.

Molecular weight: 176.97

Ref: 10-F546109