CAS 91129-84-9
:4-benzyl-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
Description:
4-Benzyl-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a heterocyclic compound characterized by its triazole ring structure, which contains nitrogen atoms in its five-membered ring. This compound features a benzyl group and a methyl group, contributing to its unique chemical properties and potential biological activities. The presence of the thione functional group (–S) indicates that it may exhibit properties similar to thiols, such as reactivity with electrophiles. The compound is typically synthesized through specific organic reactions involving triazole derivatives and may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, it is essential to handle it with care, considering potential toxicity and reactivity. Overall, 4-benzyl-5-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione represents a class of compounds that could have applications in drug development and other chemical industries.
Formula:C10H11N3S
InChI:InChI=1/C10H11N3S/c1-8-11-12-10(14)13(8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,14)
SMILES:Cc1nnc(n1Cc1ccccc1)S
Synonyms:- 3H-1,2,4-triazole-3-thione, 2,4-dihydro-5-methyl-4-(phenylmethyl)-
- 4-Benzyl-5-methyl-4H-[1,2,4]triazole-3-thiol
- 4H-1,2,4-triazole-3-thiol, 5-methyl-4-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
