
CAS 911300-68-0
:4-Methoxy-1-piperidineacetonitrile
Description:
4-Methoxy-1-piperidineacetonitrile is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a methoxy group (-OCH3) at the 4-position of the piperidine ring contributes to its unique properties, including potential solubility in organic solvents and influence on its reactivity. The acetonitrile functional group (-C≡N) attached to the piperidine adds to its polar characteristics, making it useful in various chemical reactions and applications. This compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy group and the nitrile functionality. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly. Overall, 4-Methoxy-1-piperidineacetonitrile is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H14N2O
InChI:InChI=1S/C8H14N2O/c1-11-8-2-5-10(6-3-8)7-4-9/h8H,2-3,5-7H2,1H3
InChI key:InChIKey=QRJWWHHEHMTPGG-UHFFFAOYSA-N
SMILES:C(C#N)N1CCC(OC)CC1
Synonyms:- 4-Methoxy-1-piperidineacetonitrile
- 2-(4-Methoxypiperidin-1-yl)acetonitrile
- 1-Piperidineacetonitrile, 4-methoxy-
- (4-Methoxy-1-piperidinyl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.