CAS 911305-49-2
:5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole
Description:
5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole is a chemical compound characterized by its unique structure, which includes a bromine atom and a pyrrole ring fused to an indazole framework. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine substituent. The indazole moiety contributes to its aromatic character, which can influence its electronic properties and reactivity. Additionally, the presence of the pyrrole ring may impart specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential applications in various fields, including pharmaceuticals, where it may serve as a scaffold for the development of new therapeutic agents. Its CAS number, 911305-49-2, allows for easy identification and reference in chemical databases. Overall, 5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole represents a versatile compound with significant implications in chemical research and application.
Formula:C11H8BrN3
InChI:InChI=1S/C11H8BrN3/c12-7-3-4-9-8(6-7)11(15-14-9)10-2-1-5-13-10/h1-6,13H,(H,14,15)
InChI key:InChIKey=PEAWIFZFXZVZHS-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=NNC2=CC1)C3=CC=CN3
Synonyms:- 5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole
- 1H-Indazole, 5-bromo-3-(1H-pyrrol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole
CAS:5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole
Molecular weight:262.11g/mol5-Bromo-3-(1H-pyrrol-2-yl)-1H-indazole
CAS:Controlled ProductFormula:C11H8BrN3Color and Shape:NeatMolecular weight:262.105


