CymitQuimica logo

CAS 911305-81-2

:

5-Bromo-3-(2-thienyl)-1H-indazole

Description:
5-Bromo-3-(2-thienyl)-1H-indazole is a chemical compound characterized by its unique structure, which includes an indazole core substituted with a bromine atom and a thienyl group. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The thienyl group, derived from thiophene, contributes to the compound's electronic properties and may affect its solubility and interaction with biological targets. This compound is often studied for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 5-Bromo-3-(2-thienyl)-1H-indazole represents a class of compounds that are valuable in research and development within the fields of organic and medicinal chemistry.
Formula:C11H7BrN2S
InChI:InChI=1S/C11H7BrN2S/c12-7-3-4-9-8(6-7)11(14-13-9)10-2-1-5-15-10/h1-6H,(H,13,14)
InChI key:InChIKey=HCQXXMHJJVLCNV-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=NNC2=CC1)C3=CC=CS3
Synonyms:
  • 5-Bromo-3-(2-thienyl)-1H-indazole
  • 5-Bromo-3-(thiophen-2-yl)-1H-indazole
  • 1H-Indazole, 5-bromo-3-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.