CAS 91131-04-3

2-chloro-N-[1-(p-tolyl)ethyl]acetamide

Description:

2-chloro-N-[1-(p-tolyl)ethyl]acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of a chlorine atom at the second position of the acetamide structure contributes to its reactivity and potential biological activity. The compound features a p-tolyl group, indicating a para-substituted toluene moiety, which can influence its hydrophobicity and interactions with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic characteristics. The presence of the ethyl group attached to the nitrogen atom enhances its steric bulk, which may affect its binding affinity in biological systems. As with many amides, it may participate in hydrogen bonding, influencing its physical properties and reactivity. Overall, 2-chloro-N-[1-(p-tolyl)ethyl]acetamide is of interest in medicinal chemistry and may have applications in drug development or as a chemical intermediate.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1/C11H14ClNO/c1-8-3-5-10(6-4-8)9(2)13-11(14)7-12/h3-6,9H,7H2,1-2H3,(H,13,14)

SMILES: Cc1ccc(cc1)C(C)N=C(CCl)O

2-chloro-N-[1-(4-methylphenyl)ethyl]acetamide

CAS: 91131-04-3

Formula: C₁₁H₁₄ClNO

Molecular weight: 211.6880

Ref: IN-DA006QSD

2-chloro-N-[1-(4-methylphenyl)ethyl]acetamide

CAS: 91131-04-3

Formula: C₁₁H₁₄ClNO

Purity: 95.0%

Molecular weight: 211.69

Ref: 10-F316293