CAS 91131-15-6

2-chloro-N-(4-methylbenzyl)propanamide

Description:

2-Chloro-N-(4-methylbenzyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the second carbon position and a 4-methylbenzyl group attached to the nitrogen atom contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the amide bond, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The chlorine substituent can also affect the compound's reactivity, potentially making it a candidate for nucleophilic substitution reactions. Additionally, the bulky 4-methylbenzyl group may impart steric hindrance, influencing the compound's interaction with biological systems or other chemical species. Overall, 2-chloro-N-(4-methylbenzyl)propanamide is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and synthesis.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1/C11H14ClNO/c1-8-3-5-10(6-4-8)7-13-11(14)9(2)12/h3-6,9H,7H2,1-2H3,(H,13,14)

SMILES: Cc1ccc(cc1)CN=C(C(C)Cl)O

2-Chloro-N-[(4-methylphenyl)methyl]propanamide

CAS: 91131-15-6

Versatile small molecule scaffold

Formula: C₁₁H₁₄ClNO

Purity: Min. 95%

Molecular weight: 211.69 g/mol

Ref: 3D-RDA13115